C10H15N3O2 — CID 80647845
6-N-(1,4-dioxan-2-ylmethyl)pyridine-2,6-diamine (PubChem CID 80647845) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 6-N-(1,4-dioxan-2-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-(1,4-dioxan-2-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80647845 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 6-N-(1,4-dioxan-2-ylmethyl)pyridine-2,6-diamine |
| SMILES | Nc1cccc(NCC2COCCO2)n1 |
| InChI | InChI=1S/C10H15N3O2/c11-9-2-1-3-10(13-9)12-6-8-7-14-4-5-15-8/h1-3,8H,4-7H2,(H3,11,12,13) |
| InChIKey | FFMBSMPQXRMXRU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |