C11H13ClN2O3 — CID 54908916
6-chloro-N-(1,4-dioxan-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 54908916) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is 6-chloro-N-(1,4-dioxan-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(1,4-dioxan-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 54908916 |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 6-chloro-N-(1,4-dioxan-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC1COCCO1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H13ClN2O3/c12-10-2-1-8(5-13-10)11(15)14-6-9-7-16-3-4-17-9/h1-2,5,9H,3-4,6-7H2,(H,14,15) |
| InChIKey | BIYSOEXZVDLCAX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|