C12H14ClNO4 — CID 54908530
4-chloro-N-(1,4-dioxan-2-ylmethyl)-2-hydroxybenzamide (PubChem CID 54908530) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is 4-chloro-N-(1,4-dioxan-2-ylmethyl)-2-hydroxybenzamide.
| Compound Name | 4-chloro-N-(1,4-dioxan-2-ylmethyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 54908530 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 4-chloro-N-(1,4-dioxan-2-ylmethyl)-2-hydroxybenzamide |
| SMILES | O=C(NCC1COCCO1)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C12H14ClNO4/c13-8-1-2-10(11(15)5-8)12(16)14-6-9-7-17-3-4-18-9/h1-2,5,9,15H,3-4,6-7H2,(H,14,16) |
| InChIKey | GTJDLYIDAGPLIO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |