C12H15ClN2O3 — CID 115323836
5-chloro-2-hydroxy-N-(morpholin-2-ylmethyl)benzamide (PubChem CID 115323836) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-(morpholin-2-ylmethyl)benzamide.
| Compound Name | 5-chloro-2-hydroxy-N-(morpholin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 115323836 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 5-chloro-2-hydroxy-N-(morpholin-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CNCCO1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C12H15ClN2O3/c13-8-1-2-11(16)10(5-8)12(17)15-7-9-6-14-3-4-18-9/h1-2,5,9,14,16H,3-4,6-7H2,(H,15,17) |
| InChIKey | PDFBYBYCWONITK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |