C12H13Cl2N3O4 — CID 107192102
2,3-dichloro-N-(morpholin-2-ylmethyl)-5-nitrobenzamide (PubChem CID 107192102) has the molecular formula C12H13Cl2N3O4 and a molecular weight of 334.16 g/mol. Its IUPAC name is 2,3-dichloro-N-(morpholin-2-ylmethyl)-5-nitrobenzamide.
| Compound Name | 2,3-dichloro-N-(morpholin-2-ylmethyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 107192102 |
| Molecular Formula | C12H13Cl2N3O4 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2,3-dichloro-N-(morpholin-2-ylmethyl)-5-nitrobenzamide |
| SMILES | O=C(NCC1CNCCO1)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C12H13Cl2N3O4/c13-10-4-7(17(19)20)3-9(11(10)14)12(18)16-6-8-5-15-1-2-21-8/h3-4,8,15H,1-2,5-6H2,(H,16,18) |
| InChIKey | YLTMZOGKURTPCT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|