C12H13ClF2N2O2 — CID 82772508
4-chloro-2,5-difluoro-N-(morpholin-2-ylmethyl)benzamide (PubChem CID 82772508) has the molecular formula C12H13ClF2N2O2 and a molecular weight of 290.70 g/mol. Its IUPAC name is 4-chloro-2,5-difluoro-N-(morpholin-2-ylmethyl)benzamide.
| Compound Name | 4-chloro-2,5-difluoro-N-(morpholin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 82772508 |
| Molecular Formula | C12H13ClF2N2O2 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4-chloro-2,5-difluoro-N-(morpholin-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CNCCO1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C12H13ClF2N2O2/c13-9-4-10(14)8(3-11(9)15)12(18)17-6-7-5-16-1-2-19-7/h3-4,7,16H,1-2,5-6H2,(H,17,18) |
| InChIKey | LTQOKHYATBHKAZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|