C12H14Cl2N2O2 — CID 113287074
2,6-dichloro-N-(morpholin-2-ylmethyl)benzamide (PubChem CID 113287074) has the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.16 g/mol. Its IUPAC name is 2,6-dichloro-N-(morpholin-2-ylmethyl)benzamide.
| Compound Name | 2,6-dichloro-N-(morpholin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 113287074 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2,6-dichloro-N-(morpholin-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CNCCO1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O2/c13-9-2-1-3-10(14)11(9)12(17)16-7-8-6-15-4-5-18-8/h1-3,8,15H,4-7H2,(H,16,17) |
| InChIKey | JTVCHQWYMYWIJN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |