C17H16Cl2N2O2 — CID 129387150
2,6-dichloro-N-[4-[(2R)-morpholin-2-yl]phenyl]benzamide (PubChem CID 129387150) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-[(2R)-morpholin-2-yl]phenyl]benzamide.
| Compound Name | 2,6-dichloro-N-[4-[(2R)-morpholin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 129387150 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2,6-dichloro-N-[4-[(2R)-morpholin-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc([C@@H]2CNCCO2)cc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O2/c18-13-2-1-3-14(19)16(13)17(22)21-12-6-4-11(5-7-12)15-10-20-8-9-23-15/h1-7,15,20H,8-10H2,(H,21,22)/t15-/m0/s1 |
| InChIKey | KXRLYAIFRLNIGV-HNNXBMFYSA-N |
| XLogP | 3.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |