C16H18Cl2N4O2 — CID 87325728
1-(6-chloro-2-pyridinyl)-3-(4-morpholin-2-ylphenyl)urea;hydrochloride (PubChem CID 87325728) has the molecular formula C16H18Cl2N4O2 and a molecular weight of 369.25 g/mol. Its IUPAC name is 1-(6-chloro-2-pyridinyl)-3-(4-morpholin-2-ylphenyl)urea;hydrochloride.
| Compound Name | 1-(6-chloro-2-pyridinyl)-3-(4-morpholin-2-ylphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 87325728 |
| Molecular Formula | C16H18Cl2N4O2 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-(6-chloro-2-pyridinyl)-3-(4-morpholin-2-ylphenyl)urea;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(C2CNCCO2)cc1)Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C16H17ClN4O2.ClH/c17-14-2-1-3-15(20-14)21-16(22)19-12-6-4-11(5-7-12)13-10-18-8-9-23-13;/h1-7,13,18H,8-10H2,(H2,19,20,21,22);1H |
| InChIKey | GLHMVAGLYSNPJE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|