C17H26ClN3O2 — CID 67239601
1-cyclohexyl-3-(4-morpholin-2-ylphenyl)urea;hydrochloride (PubChem CID 67239601) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4-morpholin-2-ylphenyl)urea;hydrochloride.
| Compound Name | 1-cyclohexyl-3-(4-morpholin-2-ylphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 67239601 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-cyclohexyl-3-(4-morpholin-2-ylphenyl)urea;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(C2CNCCO2)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C17H25N3O2.ClH/c21-17(19-14-4-2-1-3-5-14)20-15-8-6-13(7-9-15)16-12-18-10-11-22-16;/h6-9,14,16,18H,1-5,10-12H2,(H2,19,20,21);1H |
| InChIKey | DYMBJQNZECKPHS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |