C17H19Cl2N3O2 — CID 67241922
1-(2-chlorophenyl)-3-(4-morpholin-2-ylphenyl)urea;hydrochloride (PubChem CID 67241922) has the molecular formula C17H19Cl2N3O2 and a molecular weight of 368.26 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(4-morpholin-2-ylphenyl)urea;hydrochloride.
| Compound Name | 1-(2-chlorophenyl)-3-(4-morpholin-2-ylphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 67241922 |
| Molecular Formula | C17H19Cl2N3O2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(4-morpholin-2-ylphenyl)urea;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(C2CNCCO2)cc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H18ClN3O2.ClH/c18-14-3-1-2-4-15(14)21-17(22)20-13-7-5-12(6-8-13)16-11-19-9-10-23-16;/h1-8,16,19H,9-11H2,(H2,20,21,22);1H |
| InChIKey | TXBXEDPCWHTEDO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |