C15H22N2O3 — CID 117446363
tert-butyl N-(4-morpholin-2-ylphenyl)carbamate (PubChem CID 117446363) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is tert-butyl N-(4-morpholin-2-ylphenyl)carbamate.
| Compound Name | tert-butyl N-(4-morpholin-2-ylphenyl)carbamate |
|---|---|
| PubChem CID | 117446363 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | tert-butyl N-(4-morpholin-2-ylphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C2CNCCO2)cc1 |
| InChI | InChI=1S/C15H22N2O3/c1-15(2,3)20-14(18)17-12-6-4-11(5-7-12)13-10-16-8-9-19-13/h4-7,13,16H,8-10H2,1-3H3,(H,17,18) |
| InChIKey | HKAZEUVGRXCMPS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |