C16H17F3N4O2 — CID 164898260
4-methyl-N-(4-morpholin-2-ylphenyl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (PubChem CID 164898260) has the molecular formula C16H17F3N4O2 and a molecular weight of 354.33 g/mol. Its IUPAC name is 4-methyl-N-(4-morpholin-2-ylphenyl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 4-methyl-N-(4-morpholin-2-ylphenyl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 164898260 |
| Molecular Formula | C16H17F3N4O2 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 4-methyl-N-(4-morpholin-2-ylphenyl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(C3CNCCO3)cc2)n[nH]c1C(F)(F)F |
| InChI | InChI=1S/C16H17F3N4O2/c1-9-13(22-23-14(9)16(17,18)19)15(24)21-11-4-2-10(3-5-11)12-8-20-6-7-25-12/h2-5,12,20H,6-8H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | YYIXXEYJSZIBKN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |