C34H46N8O8S — CID 175814665
bis(5-ethyl-4-methyl-N-[4-[(2S)-morpholin-2-yl]phenyl]-1H-pyrazole-3-carboxamide);sulfuric acid (PubChem CID 175814665) has the molecular formula C34H46N8O8S and a molecular weight of 726.86 g/mol. Its IUPAC name is bis(5-ethyl-4-methyl-N-[4-[(2S)-morpholin-2-yl]phenyl]-1H-pyrazole-3-carboxamide);sulfuric acid.
| Compound Name | bis(5-ethyl-4-methyl-N-[4-[(2S)-morpholin-2-yl]phenyl]-1H-pyrazole-3-carboxamide);sulfuric acid |
|---|---|
| PubChem CID | 175814665 |
| Molecular Formula | C34H46N8O8S |
| Molecular Weight | 726.86 g/mol |
| Exact Mass | 726.32 |
| IUPAC Name | bis(5-ethyl-4-methyl-N-[4-[(2S)-morpholin-2-yl]phenyl]-1H-pyrazole-3-carboxamide);sulfuric acid |
| SMILES | CCc1[nH]nc(C(=O)Nc2ccc([C@H]3CNCCO3)cc2)c1C.CCc1[nH]nc(C(=O)Nc2ccc([C@H]3CNCCO3)cc2)c1C.O=S(=O)(O)O |
| InChI | InChI=1S/2C17H22N4O2.H2O4S/c2*1-3-14-11(2)16(21-20-14)17(22)19-13-6-4-12(5-7-13)15-10-18-8-9-23-15;1-5(2,3)4/h2*4-7,15,18H,3,8-10H2,1-2H3,(H,19,22)(H,20,21);(H2,1,2,3,4)/t2*15-;/m11./s1 |
| InChIKey | OIJARRGZBBFEIJ-QQPYHFHTSA-N |
| XLogP | 3.73 |
| TPSA | 232.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.86 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|