C18H22N4O4 — CID 170722933
2-[4-[(5-ethyl-4-methyl-1H-pyrazole-3-carbonyl)amino]phenyl]morpholine-4-carboxylic acid (PubChem CID 170722933) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-[4-[(5-ethyl-4-methyl-1H-pyrazole-3-carbonyl)amino]phenyl]morpholine-4-carboxylic acid.
| Compound Name | 2-[4-[(5-ethyl-4-methyl-1H-pyrazole-3-carbonyl)amino]phenyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 170722933 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-[4-[(5-ethyl-4-methyl-1H-pyrazole-3-carbonyl)amino]phenyl]morpholine-4-carboxylic acid |
| SMILES | CCc1[nH]nc(C(=O)Nc2ccc(C3CN(C(=O)O)CCO3)cc2)c1C |
| InChI | InChI=1S/C18H22N4O4/c1-3-14-11(2)16(21-20-14)17(23)19-13-6-4-12(5-7-13)15-10-22(18(24)25)8-9-26-15/h4-7,15H,3,8-10H2,1-2H3,(H,19,23)(H,20,21)(H,24,25) |
| InChIKey | XNZQFYROQRNOHO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |