C12H13ClN2O5 — CID 47296658
2-chloro-N-(1,4-dioxan-2-ylmethyl)-4-nitrobenzamide (PubChem CID 47296658) has the molecular formula C12H13ClN2O5 and a molecular weight of 300.70 g/mol. Its IUPAC name is 2-chloro-N-(1,4-dioxan-2-ylmethyl)-4-nitrobenzamide.
| Compound Name | 2-chloro-N-(1,4-dioxan-2-ylmethyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 47296658 |
| Molecular Formula | C12H13ClN2O5 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-chloro-N-(1,4-dioxan-2-ylmethyl)-4-nitrobenzamide |
| SMILES | O=C(NCC1COCCO1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C12H13ClN2O5/c13-11-5-8(15(17)18)1-2-10(11)12(16)14-6-9-7-19-3-4-20-9/h1-2,5,9H,3-4,6-7H2,(H,14,16) |
| InChIKey | VZCFRRMJGGQJJE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|