C12H14ClN3O5 — CID 62159802
4-amino-3-chloro-N-(1,4-dioxan-2-ylmethyl)-5-nitrobenzamide (PubChem CID 62159802) has the molecular formula C12H14ClN3O5 and a molecular weight of 315.71 g/mol. Its IUPAC name is 4-amino-3-chloro-N-(1,4-dioxan-2-ylmethyl)-5-nitrobenzamide.
| Compound Name | 4-amino-3-chloro-N-(1,4-dioxan-2-ylmethyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 62159802 |
| Molecular Formula | C12H14ClN3O5 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-amino-3-chloro-N-(1,4-dioxan-2-ylmethyl)-5-nitrobenzamide |
| SMILES | Nc1c(Cl)cc(C(=O)NCC2COCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14ClN3O5/c13-9-3-7(4-10(11(9)14)16(18)19)12(17)15-5-8-6-20-1-2-21-8/h3-4,8H,1-2,5-6,14H2,(H,15,17) |
| InChIKey | VYDWCEONUNDPEA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|