C16H25NO3 — CID 178150014
N-(1,4-dioxan-2-ylmethyl)-2,4-dimethylbenzamide;ethane (PubChem CID 178150014) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-2,4-dimethylbenzamide;ethane.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-2,4-dimethylbenzamide;ethane |
|---|---|
| PubChem CID | 178150014 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-2,4-dimethylbenzamide;ethane |
| SMILES | CC.Cc1ccc(C(=O)NCC2COCCO2)c(C)c1 |
| InChI | InChI=1S/C14H19NO3.C2H6/c1-10-3-4-13(11(2)7-10)14(16)15-8-12-9-17-5-6-18-12;1-2/h3-4,7,12H,5-6,8-9H2,1-2H3,(H,15,16);1-2H3 |
| InChIKey | XDWIHCKPJIULNF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |