C14H21N3O3 — CID 61102161
5-amino-2-(dimethylamino)-N-(1,4-dioxan-2-ylmethyl)benzamide (PubChem CID 61102161) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 5-amino-2-(dimethylamino)-N-(1,4-dioxan-2-ylmethyl)benzamide.
| Compound Name | 5-amino-2-(dimethylamino)-N-(1,4-dioxan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 61102161 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 5-amino-2-(dimethylamino)-N-(1,4-dioxan-2-ylmethyl)benzamide |
| SMILES | CN(C)c1ccc(N)cc1C(=O)NCC1COCCO1 |
| InChI | InChI=1S/C14H21N3O3/c1-17(2)13-4-3-10(15)7-12(13)14(18)16-8-11-9-19-5-6-20-11/h3-4,7,11H,5-6,8-9,15H2,1-2H3,(H,16,18) |
| InChIKey | PZZFERCYSPCGKF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|