C13H19N3O3 — CID 62509083
N-(1,4-dioxan-2-ylmethyl)-2-hydrazinyl-5-methylbenzamide (PubChem CID 62509083) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-2-hydrazinyl-5-methylbenzamide.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-2-hydrazinyl-5-methylbenzamide |
|---|---|
| PubChem CID | 62509083 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-2-hydrazinyl-5-methylbenzamide |
| SMILES | Cc1ccc(NN)c(C(=O)NCC2COCCO2)c1 |
| InChI | InChI=1S/C13H19N3O3/c1-9-2-3-12(16-14)11(6-9)13(17)15-7-10-8-18-4-5-19-10/h2-3,6,10,16H,4-5,7-8,14H2,1H3,(H,15,17) |
| InChIKey | DKJAZRPTLBAPEG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|