C12H11Cl2N3O4 — CID 107188968
2,3-dichloro-5-nitro-N-[(5-oxopyrrolidin-2-yl)methyl]benzamide (PubChem CID 107188968) has the molecular formula C12H11Cl2N3O4 and a molecular weight of 332.14 g/mol. Its IUPAC name is 2,3-dichloro-5-nitro-N-[(5-oxopyrrolidin-2-yl)methyl]benzamide.
| Compound Name | 2,3-dichloro-5-nitro-N-[(5-oxopyrrolidin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 107188968 |
| Molecular Formula | C12H11Cl2N3O4 |
| Molecular Weight | 332.14 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 2,3-dichloro-5-nitro-N-[(5-oxopyrrolidin-2-yl)methyl]benzamide |
| SMILES | O=C1CCC(CNC(=O)c2cc([N+](=O)[O-])cc(Cl)c2Cl)N1 |
| InChI | InChI=1S/C12H11Cl2N3O4/c13-9-4-7(17(20)21)3-8(11(9)14)12(19)15-5-6-1-2-10(18)16-6/h3-4,6H,1-2,5H2,(H,15,19)(H,16,18) |
| InChIKey | OECGKCVTVKPQPV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.14 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|