C13H16Cl2N2O4 — CID 106140061
2,3-dichloro-N-(4-hydroxy-2,2-dimethylbutyl)-5-nitrobenzamide (PubChem CID 106140061) has the molecular formula C13H16Cl2N2O4 and a molecular weight of 335.19 g/mol. Its IUPAC name is 2,3-dichloro-N-(4-hydroxy-2,2-dimethylbutyl)-5-nitrobenzamide.
| Compound Name | 2,3-dichloro-N-(4-hydroxy-2,2-dimethylbutyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 106140061 |
| Molecular Formula | C13H16Cl2N2O4 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2,3-dichloro-N-(4-hydroxy-2,2-dimethylbutyl)-5-nitrobenzamide |
| SMILES | CC(C)(CCO)CNC(=O)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C13H16Cl2N2O4/c1-13(2,3-4-18)7-16-12(19)9-5-8(17(20)21)6-10(14)11(9)15/h5-6,18H,3-4,7H2,1-2H3,(H,16,19) |
| InChIKey | ONQVEEQHRZFYMV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|