C12H13Cl2N3O4 — CID 107362916
N-(3-amino-2,2-dimethyl-3-oxopropyl)-2,3-dichloro-5-nitrobenzamide (PubChem CID 107362916) has the molecular formula C12H13Cl2N3O4 and a molecular weight of 334.16 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethyl-3-oxopropyl)-2,3-dichloro-5-nitrobenzamide.
| Compound Name | N-(3-amino-2,2-dimethyl-3-oxopropyl)-2,3-dichloro-5-nitrobenzamide |
|---|---|
| PubChem CID | 107362916 |
| Molecular Formula | C12H13Cl2N3O4 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-(3-amino-2,2-dimethyl-3-oxopropyl)-2,3-dichloro-5-nitrobenzamide |
| SMILES | CC(C)(CNC(=O)c1cc([N+](=O)[O-])cc(Cl)c1Cl)C(N)=O |
| InChI | InChI=1S/C12H13Cl2N3O4/c1-12(2,11(15)19)5-16-10(18)7-3-6(17(20)21)4-8(13)9(7)14/h3-4H,5H2,1-2H3,(H2,15,19)(H,16,18) |
| InChIKey | RPJKAANCFCTRGS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|