C11H13ClN4O2 — CID 114045997
5-amino-2-chloro-N-[(5-oxopyrrolidin-2-yl)methyl]pyridine-3-carboxamide (PubChem CID 114045997) has the molecular formula C11H13ClN4O2 and a molecular weight of 268.70 g/mol. Its IUPAC name is 5-amino-2-chloro-N-[(5-oxopyrrolidin-2-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 5-amino-2-chloro-N-[(5-oxopyrrolidin-2-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114045997 |
| Molecular Formula | C11H13ClN4O2 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 5-amino-2-chloro-N-[(5-oxopyrrolidin-2-yl)methyl]pyridine-3-carboxamide |
| SMILES | Nc1cnc(Cl)c(C(=O)NCC2CCC(=O)N2)c1 |
| InChI | InChI=1S/C11H13ClN4O2/c12-10-8(3-6(13)4-14-10)11(18)15-5-7-1-2-9(17)16-7/h3-4,7H,1-2,5,13H2,(H,15,18)(H,16,17) |
| InChIKey | OOHCQIMPHRPOJM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|