C10H12ClN3O4 — CID 114046104
methyl 3-[(5-amino-2-chloropyridine-3-carbonyl)amino]-2-hydroxypropanoate (PubChem CID 114046104) has the molecular formula C10H12ClN3O4 and a molecular weight of 273.68 g/mol. Its IUPAC name is methyl 3-[(5-amino-2-chloropyridine-3-carbonyl)amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(5-amino-2-chloropyridine-3-carbonyl)amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 114046104 |
| Molecular Formula | C10H12ClN3O4 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | methyl 3-[(5-amino-2-chloropyridine-3-carbonyl)amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1cc(N)cnc1Cl |
| InChI | InChI=1S/C10H12ClN3O4/c1-18-10(17)7(15)4-14-9(16)6-2-5(12)3-13-8(6)11/h2-3,7,15H,4,12H2,1H3,(H,14,16) |
| InChIKey | ZKCSAKCGIYOTHY-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|