C11H14ClN3O3 — CID 114045972
ethyl 3-[(5-amino-2-chloropyridine-3-carbonyl)amino]propanoate (PubChem CID 114045972) has the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. Its IUPAC name is ethyl 3-[(5-amino-2-chloropyridine-3-carbonyl)amino]propanoate.
| Compound Name | ethyl 3-[(5-amino-2-chloropyridine-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 114045972 |
| Molecular Formula | C11H14ClN3O3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | ethyl 3-[(5-amino-2-chloropyridine-3-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)c1cc(N)cnc1Cl |
| InChI | InChI=1S/C11H14ClN3O3/c1-2-18-9(16)3-4-14-11(17)8-5-7(13)6-15-10(8)12/h5-6H,2-4,13H2,1H3,(H,14,17) |
| InChIKey | WRLCGJCJFIPUFY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|