C10H13ClN4O2 — CID 114046062
5-amino-N-(4-amino-4-oxobutan-2-yl)-2-chloropyridine-3-carboxamide (PubChem CID 114046062) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is 5-amino-N-(4-amino-4-oxobutan-2-yl)-2-chloropyridine-3-carboxamide.
| Compound Name | 5-amino-N-(4-amino-4-oxobutan-2-yl)-2-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 114046062 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 5-amino-N-(4-amino-4-oxobutan-2-yl)-2-chloropyridine-3-carboxamide |
| SMILES | CC(CC(N)=O)NC(=O)c1cc(N)cnc1Cl |
| InChI | InChI=1S/C10H13ClN4O2/c1-5(2-8(13)16)15-10(17)7-3-6(12)4-14-9(7)11/h3-5H,2,12H2,1H3,(H2,13,16)(H,15,17) |
| InChIKey | BPPKZBRTRTVIBY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|