C12H19N3O — CID 61040311
5-amino-2-methyl-N-pentan-2-ylpyridine-3-carboxamide (PubChem CID 61040311) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 5-amino-2-methyl-N-pentan-2-ylpyridine-3-carboxamide.
| Compound Name | 5-amino-2-methyl-N-pentan-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 61040311 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 5-amino-2-methyl-N-pentan-2-ylpyridine-3-carboxamide |
| SMILES | CCCC(C)NC(=O)c1cc(N)cnc1C |
| InChI | InChI=1S/C12H19N3O/c1-4-5-8(2)15-12(16)11-6-10(13)7-14-9(11)3/h6-8H,4-5,13H2,1-3H3,(H,15,16) |
| InChIKey | RVZGUCMLPNJENH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |