C12H18N4O2 — CID 54917009
5-amino-2-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]pyridine-3-carboxamide (PubChem CID 54917009) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]pyridine-3-carboxamide.
| Compound Name | 5-amino-2-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 54917009 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 5-amino-2-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]pyridine-3-carboxamide |
| SMILES | Cc1ncc(N)cc1C(=O)NCC(=O)NC(C)C |
| InChI | InChI=1S/C12H18N4O2/c1-7(2)16-11(17)6-15-12(18)10-4-9(13)5-14-8(10)3/h4-5,7H,6,13H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | BJFIQONKNVJCTR-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |