C11H14N2O4 — CID 107723793
N-(4-amino-4-oxobutan-2-yl)-2,5-dihydroxybenzamide (PubChem CID 107723793) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is N-(4-amino-4-oxobutan-2-yl)-2,5-dihydroxybenzamide.
| Compound Name | N-(4-amino-4-oxobutan-2-yl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107723793 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | N-(4-amino-4-oxobutan-2-yl)-2,5-dihydroxybenzamide |
| SMILES | CC(CC(N)=O)NC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C11H14N2O4/c1-6(4-10(12)16)13-11(17)8-5-7(14)2-3-9(8)15/h2-3,5-6,14-15H,4H2,1H3,(H2,12,16)(H,13,17) |
| InChIKey | DJCKNLADHKJZQH-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|