C12H14N2O6 — CID 107721564
5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid (PubChem CID 107721564) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107721564 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)c1cc(O)ccc1O)C(=O)O |
| InChI | InChI=1S/C12H14N2O6/c13-10(17)4-2-8(12(19)20)14-11(18)7-5-6(15)1-3-9(7)16/h1,3,5,8,15-16H,2,4H2,(H2,13,17)(H,14,18)(H,19,20) |
| InChIKey | NXANUBCVNBDFBC-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|