5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid

C12H14N2O6 — CID 107721564

IUPAC5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid
SMILESNC(=O)CCC(NC(=O)c1cc(O)ccc1O)C(=O)O
InChIInChI=1S/C12H14N2O6/c13-10(17)4-2-8(12(19)20)14-11(18)7-5-6(15)1-3-9(7)16/h1,3,5,8,15-16H,2,4H2,(H2,13,17)(H,14,18)(H,19,20)
InChIKeyNXANUBCVNBDFBC-UHFFFAOYSA-N
MW282.25 g/mol
LogP-0.45
Rot. Bonds6

About 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid

5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid (PubChem CID 107721564) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid.

Molecular Properties

Compound Name5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid
PubChem CID107721564
Molecular FormulaC12H14N2O6
Molecular Weight282.25 g/mol
Exact Mass282.09
IUPAC Name5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid
SMILESNC(=O)CCC(NC(=O)c1cc(O)ccc1O)C(=O)O
InChIInChI=1S/C12H14N2O6/c13-10(17)4-2-8(12(19)20)14-11(18)7-5-6(15)1-3-9(7)16/h1,3,5,8,15-16H,2,4H2,(H2,13,17)(H,14,18)(H,19,20)
InChIKeyNXANUBCVNBDFBC-UHFFFAOYSA-N
XLogP-0.45
TPSA149.95 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.25
LogP ≤ 5-0.45
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydroquinone', 'substructure': 'N/A'}

Analyze 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid?
The IUPAC name of 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid (CID 107721564) is 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid.
What is the SMILES notation for 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid?
The canonical SMILES for 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid is NC(=O)CCC(NC(=O)c1cc(O)ccc1O)C(=O)O.
What is the InChIKey of 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid?
The InChIKey is NXANUBCVNBDFBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O6/c13-10(17)4-2-8(12(19)20)14-11(18)7-5-6(15)1-3-9(7)16/h1,3,5,8,15-16H,2,4H2,(H2,13,17)(H,14,18)(H,19,20).
What are the key properties of 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid?
5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid has a molecular weight of 282.25 g/mol, XLogP of -0.45, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-[(2,5-dihydroxybenzoyl)amino]-5-oxopentanoic acid is sourced from PubChem (CID 107721564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).