C28H44N6O9 — CID 73348716
(2S)-2-[[(2S,3S)-2-[[(2S)-5-amino-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]butanoic acid (PubChem CID 73348716) has the molecular formula C28H44N6O9 and a molecular weight of 608.69 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-2-[[(2S)-5-amino-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[(2S,3S)-2-[[(2S)-5-amino-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 73348716 |
| Molecular Formula | C28H44N6O9 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | (2S)-2-[[(2S,3S)-2-[[(2S)-5-amino-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]butanoic acid |
| SMILES | CC[C@H](NC(=O)[C@@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)c1cc(O)ccc1O)[C@@H](C)CC)C(=O)O |
| InChI | InChI=1S/C28H44N6O9/c1-4-15(3)23(27(41)31-18(5-2)28(42)43)34-26(40)20(10-12-22(30)37)33-25(39)19(8-6-7-13-29)32-24(38)17-14-16(35)9-11-21(17)36/h9,11,14-15,18-20,23,35-36H,4-8,10,12-13,29H2,1-3H3,(H2,30,37)(H,31,41)(H,32,38)(H,33,39)(H,34,40)(H,42,43)/t15-,18-,19-,20-,23-/m0/s1 |
| InChIKey | WNTQOLPVRCSYAR-GJLLLRFJSA-N |
| XLogP | -0.41 |
| TPSA | 263.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|