C29H47N7O8 — CID 23349691
6-amino-2-[[5-amino-2-[[2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid (PubChem CID 23349691) has the molecular formula C29H47N7O8 and a molecular weight of 621.74 g/mol. Its IUPAC name is 6-amino-2-[[5-amino-2-[[2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[5-amino-2-[[2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 23349691 |
| Molecular Formula | C29H47N7O8 |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.35 |
| IUPAC Name | 6-amino-2-[[5-amino-2-[[2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(C)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCC(N)=O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C29H47N7O8/c1-4-16(2)24(36-25(39)17(3)33-26(40)20(31)15-18-8-10-19(37)11-9-18)28(42)34-21(12-13-23(32)38)27(41)35-22(29(43)44)7-5-6-14-30/h8-11,16-17,20-22,24,37H,4-7,12-15,30-31H2,1-3H3,(H2,32,38)(H,33,40)(H,34,42)(H,35,41)(H,36,39)(H,43,44) |
| InChIKey | ISZPNAUIQCKYNI-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 269.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|