C24H39N5O6S — CID 19953674
6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid (PubChem CID 19953674) has the molecular formula C24H39N5O6S and a molecular weight of 525.67 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19953674 |
| Molecular Formula | C24H39N5O6S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CS)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C24H39N5O6S/c1-3-14(2)20(29-21(31)17(26)12-15-7-9-16(30)10-8-15)23(33)28-19(13-36)22(32)27-18(24(34)35)6-4-5-11-25/h7-10,14,17-20,30,36H,3-6,11-13,25-26H2,1-2H3,(H,27,32)(H,28,33)(H,29,31)(H,34,35) |
| InChIKey | XAVPDBBWSCXTRA-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|