C27H41N5O8S — CID 73354794
(2S)-2-[[(2S,3S)-2-[[(4R)-3-[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]-1,3-thiazolidine-4-carbonyl]amino]-3-methylpentanoyl]amino]butanoic acid (PubChem CID 73354794) has the molecular formula C27H41N5O8S and a molecular weight of 595.72 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-2-[[(4R)-3-[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]-1,3-thiazolidine-4-carbonyl]amino]-3-methylpentanoyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[(2S,3S)-2-[[(4R)-3-[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]-1,3-thiazolidine-4-carbonyl]amino]-3-methylpentanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 73354794 |
| Molecular Formula | C27H41N5O8S |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | (2S)-2-[[(2S,3S)-2-[[(4R)-3-[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]-1,3-thiazolidine-4-carbonyl]amino]-3-methylpentanoyl]amino]butanoic acid |
| SMILES | CC[C@H](NC(=O)[C@@H](NC(=O)[C@@H]1CSCN1C(=O)[C@H](CCCCN)NC(=O)c1cc(O)ccc1O)[C@@H](C)CC)C(=O)O |
| InChI | InChI=1S/C27H41N5O8S/c1-4-15(3)22(25(37)29-18(5-2)27(39)40)31-24(36)20-13-41-14-32(20)26(38)19(8-6-7-11-28)30-23(35)17-12-16(33)9-10-21(17)34/h9-10,12,15,18-20,22,33-34H,4-8,11,13-14,28H2,1-3H3,(H,29,37)(H,30,35)(H,31,36)(H,39,40)/t15-,18-,19-,20-,22-/m0/s1 |
| InChIKey | DIYAJKVRYNUFBW-BTAJCFKJSA-N |
| XLogP | 0.74 |
| TPSA | 211.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|