C34H49N5O8 — CID 73347210
6-[[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 73347210) has the molecular formula C34H49N5O8 and a molecular weight of 655.79 g/mol. Its IUPAC name is 6-[[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-[[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 73347210 |
| Molecular Formula | C34H49N5O8 |
| Molecular Weight | 655.79 g/mol |
| Exact Mass | 655.36 |
| IUPAC Name | 6-[[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)c1cc(O)ccc1O)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C34H49N5O8/c1-3-22(2)30(39-33(46)26(14-9-10-18-35)37-31(44)25-21-24(40)16-17-28(25)41)34(47)38-27(20-23-12-6-4-7-13-23)32(45)36-19-11-5-8-15-29(42)43/h4,6-7,12-13,16-17,21-22,26-27,30,40-41H,3,5,8-11,14-15,18-20,35H2,1-2H3,(H,36,45)(H,37,44)(H,38,47)(H,39,46)(H,42,43)/t22-,26-,27-,30-/m0/s1 |
| InChIKey | DWEQQGAXHDFZLF-GCIMQLSOSA-N |
| XLogP | 2.34 |
| TPSA | 220.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.79 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|