C32H45N5O8 — CID 73356324
(2S)-2-[[(2S,3S)-2-[[(2S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoyl]amino]butanoic acid (PubChem CID 73356324) has the molecular formula C32H45N5O8 and a molecular weight of 627.74 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-2-[[(2S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[(2S,3S)-2-[[(2S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 73356324 |
| Molecular Formula | C32H45N5O8 |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.33 |
| IUPAC Name | (2S)-2-[[(2S,3S)-2-[[(2S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoyl]amino]butanoic acid |
| SMILES | CC[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCN)NC(=O)c1cc(O)ccc1O)[C@@H](C)CC)C(=O)O |
| InChI | InChI=1S/C32H45N5O8/c1-4-19(3)27(31(43)34-23(5-2)32(44)45)37-30(42)25(17-20-11-7-6-8-12-20)36-29(41)24(13-9-10-16-33)35-28(40)22-18-21(38)14-15-26(22)39/h6-8,11-12,14-15,18-19,23-25,27,38-39H,4-5,9-10,13,16-17,33H2,1-3H3,(H,34,43)(H,35,40)(H,36,41)(H,37,42)(H,44,45)/t19-,23-,24-,25-,27-/m0/s1 |
| InChIKey | VPNWSWQSODGQDU-YLGVKUCZSA-N |
| XLogP | 1.56 |
| TPSA | 220.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|