C10H12N2O3S — CID 107722051
N-(1-amino-1-sulfanylidenepropan-2-yl)-2,5-dihydroxybenzamide (PubChem CID 107722051) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenepropan-2-yl)-2,5-dihydroxybenzamide.
| Compound Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107722051 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-2,5-dihydroxybenzamide |
| SMILES | CC(NC(=O)c1cc(O)ccc1O)C(N)=S |
| InChI | InChI=1S/C10H12N2O3S/c1-5(9(11)16)12-10(15)7-4-6(13)2-3-8(7)14/h2-5,13-14H,1H3,(H2,11,16)(H,12,15) |
| InChIKey | YXCURFCXYVQLAI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|