C14H20N2O4 — CID 107723639
N-[1-(diethylamino)-1-oxopropan-2-yl]-2,5-dihydroxybenzamide (PubChem CID 107723639) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is N-[1-(diethylamino)-1-oxopropan-2-yl]-2,5-dihydroxybenzamide.
| Compound Name | N-[1-(diethylamino)-1-oxopropan-2-yl]-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107723639 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-[1-(diethylamino)-1-oxopropan-2-yl]-2,5-dihydroxybenzamide |
| SMILES | CCN(CC)C(=O)C(C)NC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H20N2O4/c1-4-16(5-2)14(20)9(3)15-13(19)11-8-10(17)6-7-12(11)18/h6-9,17-18H,4-5H2,1-3H3,(H,15,19) |
| InChIKey | CSPZCYDMRBVSMD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|