C15H24N2O3 — CID 60926055
3-[1-(2,5-dihydroxyphenyl)ethylamino]-N,N-diethylpropanamide (PubChem CID 60926055) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-[1-(2,5-dihydroxyphenyl)ethylamino]-N,N-diethylpropanamide.
| Compound Name | 3-[1-(2,5-dihydroxyphenyl)ethylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 60926055 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 3-[1-(2,5-dihydroxyphenyl)ethylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNC(C)c1cc(O)ccc1O |
| InChI | InChI=1S/C15H24N2O3/c1-4-17(5-2)15(20)8-9-16-11(3)13-10-12(18)6-7-14(13)19/h6-7,10-11,16,18-19H,4-5,8-9H2,1-3H3 |
| InChIKey | NCICKUURGPDNTQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|