C17H28N2O2 — CID 60926168
3-[1-(4-ethoxyphenyl)ethylamino]-N,N-diethylpropanamide (PubChem CID 60926168) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-[1-(4-ethoxyphenyl)ethylamino]-N,N-diethylpropanamide.
| Compound Name | 3-[1-(4-ethoxyphenyl)ethylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 60926168 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 3-[1-(4-ethoxyphenyl)ethylamino]-N,N-diethylpropanamide |
| SMILES | CCOc1ccc(C(C)NCCC(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C17H28N2O2/c1-5-19(6-2)17(20)12-13-18-14(4)15-8-10-16(11-9-15)21-7-3/h8-11,14,18H,5-7,12-13H2,1-4H3 |
| InChIKey | HREKDQIBODJADR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |