C11H12INO4 — CID 107731245
3-[(2-hydroxy-5-iodobenzoyl)amino]butanoic acid (PubChem CID 107731245) has the molecular formula C11H12INO4 and a molecular weight of 349.12 g/mol. Its IUPAC name is 3-[(2-hydroxy-5-iodobenzoyl)amino]butanoic acid.
| Compound Name | 3-[(2-hydroxy-5-iodobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107731245 |
| Molecular Formula | C11H12INO4 |
| Molecular Weight | 349.12 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 3-[(2-hydroxy-5-iodobenzoyl)amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)c1cc(I)ccc1O |
| InChI | InChI=1S/C11H12INO4/c1-6(4-10(15)16)13-11(17)8-5-7(12)2-3-9(8)14/h2-3,5-6,14H,4H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | WRKWVCSBMHJAQD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.12 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|