C12H12INO2 — CID 103579022
2-hydroxy-5-iodo-N-pent-1-yn-3-ylbenzamide (PubChem CID 103579022) has the molecular formula C12H12INO2 and a molecular weight of 329.14 g/mol. Its IUPAC name is 2-hydroxy-5-iodo-N-pent-1-yn-3-ylbenzamide.
| Compound Name | 2-hydroxy-5-iodo-N-pent-1-yn-3-ylbenzamide |
|---|---|
| PubChem CID | 103579022 |
| Molecular Formula | C12H12INO2 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 2-hydroxy-5-iodo-N-pent-1-yn-3-ylbenzamide |
| SMILES | C#CC(CC)NC(=O)c1cc(I)ccc1O |
| InChI | InChI=1S/C12H12INO2/c1-3-9(4-2)14-12(16)10-7-8(13)5-6-11(10)15/h1,5-7,9,15H,4H2,2H3,(H,14,16) |
| InChIKey | RTZRABNBCOSBES-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|