C13H18INO2S — CID 103713644
N-(4-ethylsulfanylbutan-2-yl)-2-hydroxy-5-iodobenzamide (PubChem CID 103713644) has the molecular formula C13H18INO2S and a molecular weight of 379.26 g/mol. Its IUPAC name is N-(4-ethylsulfanylbutan-2-yl)-2-hydroxy-5-iodobenzamide.
| Compound Name | N-(4-ethylsulfanylbutan-2-yl)-2-hydroxy-5-iodobenzamide |
|---|---|
| PubChem CID | 103713644 |
| Molecular Formula | C13H18INO2S |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | N-(4-ethylsulfanylbutan-2-yl)-2-hydroxy-5-iodobenzamide |
| SMILES | CCSCCC(C)NC(=O)c1cc(I)ccc1O |
| InChI | InChI=1S/C13H18INO2S/c1-3-18-7-6-9(2)15-13(17)11-8-10(14)4-5-12(11)16/h4-5,8-9,16H,3,6-7H2,1-2H3,(H,15,17) |
| InChIKey | PMOMYTQCJWVUFC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|