C12H16INO2S — CID 113351481
2-hydroxy-5-iodo-N-(1-methylsulfanylbutan-2-yl)benzamide (PubChem CID 113351481) has the molecular formula C12H16INO2S and a molecular weight of 365.24 g/mol. Its IUPAC name is 2-hydroxy-5-iodo-N-(1-methylsulfanylbutan-2-yl)benzamide.
| Compound Name | 2-hydroxy-5-iodo-N-(1-methylsulfanylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 113351481 |
| Molecular Formula | C12H16INO2S |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 2-hydroxy-5-iodo-N-(1-methylsulfanylbutan-2-yl)benzamide |
| SMILES | CCC(CSC)NC(=O)c1cc(I)ccc1O |
| InChI | InChI=1S/C12H16INO2S/c1-3-9(7-17-2)14-12(16)10-6-8(13)4-5-11(10)15/h4-6,9,15H,3,7H2,1-2H3,(H,14,16) |
| InChIKey | GLCKHSZICFDORP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|