C11H12INO5 — CID 107731415
2-[(2-hydroxy-5-iodobenzoyl)amino]-3-methoxypropanoic acid (PubChem CID 107731415) has the molecular formula C11H12INO5 and a molecular weight of 365.12 g/mol. Its IUPAC name is 2-[(2-hydroxy-5-iodobenzoyl)amino]-3-methoxypropanoic acid.
| Compound Name | 2-[(2-hydroxy-5-iodobenzoyl)amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 107731415 |
| Molecular Formula | C11H12INO5 |
| Molecular Weight | 365.12 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 2-[(2-hydroxy-5-iodobenzoyl)amino]-3-methoxypropanoic acid |
| SMILES | COCC(NC(=O)c1cc(I)ccc1O)C(=O)O |
| InChI | InChI=1S/C11H12INO5/c1-18-5-8(11(16)17)13-10(15)7-4-6(12)2-3-9(7)14/h2-4,8,14H,5H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | JJLLBGLEQZVEMF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.12 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|