C11H14FN5O2 — CID 105388397
3-fluoro-2-hydrazinyl-N-[(5-oxopyrrolidin-2-yl)methyl]pyridine-4-carboxamide (PubChem CID 105388397) has the molecular formula C11H14FN5O2 and a molecular weight of 267.26 g/mol. Its IUPAC name is 3-fluoro-2-hydrazinyl-N-[(5-oxopyrrolidin-2-yl)methyl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-hydrazinyl-N-[(5-oxopyrrolidin-2-yl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105388397 |
| Molecular Formula | C11H14FN5O2 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3-fluoro-2-hydrazinyl-N-[(5-oxopyrrolidin-2-yl)methyl]pyridine-4-carboxamide |
| SMILES | NNc1nccc(C(=O)NCC2CCC(=O)N2)c1F |
| InChI | InChI=1S/C11H14FN5O2/c12-9-7(3-4-14-10(9)17-13)11(19)15-5-6-1-2-8(18)16-6/h3-4,6H,1-2,5,13H2,(H,14,17)(H,15,19)(H,16,18) |
| InChIKey | MDUNRTPFETXFQG-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|