C10H9Cl2N3O3 — CID 107192016
N-(azetidin-3-yl)-2,3-dichloro-5-nitrobenzamide (PubChem CID 107192016) has the molecular formula C10H9Cl2N3O3 and a molecular weight of 290.11 g/mol. Its IUPAC name is N-(azetidin-3-yl)-2,3-dichloro-5-nitrobenzamide.
| Compound Name | N-(azetidin-3-yl)-2,3-dichloro-5-nitrobenzamide |
|---|---|
| PubChem CID | 107192016 |
| Molecular Formula | C10H9Cl2N3O3 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | N-(azetidin-3-yl)-2,3-dichloro-5-nitrobenzamide |
| SMILES | O=C(NC1CNC1)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C10H9Cl2N3O3/c11-8-2-6(15(17)18)1-7(9(8)12)10(16)14-5-3-13-4-5/h1-2,5,13H,3-4H2,(H,14,16) |
| InChIKey | CCWNGKMHFVIKNV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|