C10H8Cl2N2O4 — CID 107191715
(2,3-dichloro-5-nitrophenyl)-(3-hydroxyazetidin-1-yl)methanone (PubChem CID 107191715) has the molecular formula C10H8Cl2N2O4 and a molecular weight of 291.09 g/mol. Its IUPAC name is (2,3-dichloro-5-nitrophenyl)-(3-hydroxyazetidin-1-yl)methanone.
| Compound Name | (2,3-dichloro-5-nitrophenyl)-(3-hydroxyazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 107191715 |
| Molecular Formula | C10H8Cl2N2O4 |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | (2,3-dichloro-5-nitrophenyl)-(3-hydroxyazetidin-1-yl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])cc(Cl)c1Cl)N1CC(O)C1 |
| InChI | InChI=1S/C10H8Cl2N2O4/c11-8-2-5(14(17)18)1-7(9(8)12)10(16)13-3-6(15)4-13/h1-2,6,15H,3-4H2 |
| InChIKey | YFEXCYABBCHTFM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|