C9H9N3O5 — CID 63106058
3-(3-hydroxyazetidine-1-carbonyl)-5-nitro-1H-pyridin-2-one (PubChem CID 63106058) has the molecular formula C9H9N3O5 and a molecular weight of 239.19 g/mol. Its IUPAC name is 3-(3-hydroxyazetidine-1-carbonyl)-5-nitro-1H-pyridin-2-one.
| Compound Name | 3-(3-hydroxyazetidine-1-carbonyl)-5-nitro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 63106058 |
| Molecular Formula | C9H9N3O5 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 3-(3-hydroxyazetidine-1-carbonyl)-5-nitro-1H-pyridin-2-one |
| SMILES | O=C(c1cc([N+](=O)[O-])c[nH]c1=O)N1CC(O)C1 |
| InChI | InChI=1S/C9H9N3O5/c13-6-3-11(4-6)9(15)7-1-5(12(16)17)2-10-8(7)14/h1-2,6,13H,3-4H2,(H,10,14) |
| InChIKey | VPBJLVOQQRDKBY-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|